C24H25NO5 — CID 23919681
prop-2-enyl (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-5-oxo-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 23919681) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is prop-2-enyl (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-5-oxo-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | prop-2-enyl (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-5-oxo-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 23919681 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | prop-2-enyl (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-5-oxo-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | C=CCOC(=O)[C@@]1(Cc2ccccc2)C[C@H]2CO[C@H](c3ccc(OC)cc3)N2C1=O |
| InChI | InChI=1S/C24H25NO5/c1-3-13-29-23(27)24(14-17-7-5-4-6-8-17)15-19-16-30-21(25(19)22(24)26)18-9-11-20(28-2)12-10-18/h3-12,19,21H,1,13-16H2,2H3/t19-,21+,24-/m0/s1 |
| InChIKey | NZEULWFWASAUKC-LEEZEASISA-N |
| XLogP | 3.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|