About 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid
7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid (PubChem CID 23920303) has the molecular formula C17H30N2O3
and a molecular weight of 310.44 g/mol. Its IUPAC name is 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid.
Molecular Properties
| Compound Name | 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid |
| PubChem CID | 23920303 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid |
| SMILES | CC(C)=CCC[C@@H](C)C/C=N/NC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C17H30N2O3/c1-14(2)8-7-9-15(3)12-13-18-19-16(20)10-5-4-6-11-17(21)22/h8,13,15H,4-7,9-12H2,1-3H3,(H,19,20)(H,21,22)/b18-13+/t15-/m1/s1 |
| InChIKey | ZSUZMJJSGWFUMA-COYFKBPASA-N |
| XLogP | 3.90 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid?
The IUPAC name of 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid (CID 23920303) is 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid.
What is the SMILES notation for 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid?
The canonical SMILES for 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid is CC(C)=CCC[C@@H](C)C/C=N/NC(=O)CCCCCC(=O)O.
What is the InChIKey of 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid?
The InChIKey is ZSUZMJJSGWFUMA-COYFKBPASA-N. The full InChI is InChI=1S/C17H30N2O3/c1-14(2)8-7-9-15(3)12-13-18-19-16(20)10-5-4-6-11-17(21)22/h8,13,15H,4-7,9-12H2,1-3H3,(H,19,20)(H,21,22)/b18-13+/t15-/m1/s1.
What are the key properties of 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid?
7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid has a molecular weight of 310.44 g/mol, XLogP of 3.90, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2E)-2-[(3R)-3,7-dimethyloct-6-enylidene]hydrazinyl]-7-oxoheptanoic acid is sourced from PubChem (CID 23920303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).