About [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate
[(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate (PubChem CID 23920364) has the molecular formula C14H19BrO4S
and a molecular weight of 363.27 g/mol. Its IUPAC name is [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate.
Molecular Properties
| Compound Name | [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate |
| PubChem CID | 23920364 |
| Molecular Formula | C14H19BrO4S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate |
| SMILES | CC(C)(CCOC(=O)CS)[C@H](O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H19BrO4S/c1-14(2,5-6-19-12(17)8-20)13(18)10-7-9(15)3-4-11(10)16/h3-4,7,13,16,18,20H,5-6,8H2,1-2H3/t13-/m1/s1 |
| InChIKey | UPPYCOITWSXFKU-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate?
The IUPAC name of [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate (CID 23920364) is [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate.
What is the SMILES notation for [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate?
The canonical SMILES for [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate is CC(C)(CCOC(=O)CS)[C@H](O)c1cc(Br)ccc1O.
What is the InChIKey of [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate?
The InChIKey is UPPYCOITWSXFKU-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H19BrO4S/c1-14(2,5-6-19-12(17)8-20)13(18)10-7-9(15)3-4-11(10)16/h3-4,7,13,16,18,20H,5-6,8H2,1-2H3/t13-/m1/s1.
What are the key properties of [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate?
[(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate has a molecular weight of 363.27 g/mol, XLogP of 3.08, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3,3-dimethylbutyl] 2-sulfanylacetate is sourced from PubChem (CID 23920364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).