About (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one
(3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one (PubChem CID 2392104) has the molecular formula C18H19NOS2
and a molecular weight of 329.49 g/mol. Its IUPAC name is (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one.
Molecular Properties
| Compound Name | (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one |
| PubChem CID | 2392104 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one |
| SMILES | CCCN1C/C(=C/c2ccsc2)C(=O)/C(=C/c2ccsc2)C1 |
| InChI | InChI=1S/C18H19NOS2/c1-2-5-19-10-16(8-14-3-6-21-12-14)18(20)17(11-19)9-15-4-7-22-13-15/h3-4,6-9,12-13H,2,5,10-11H2,1H3/b16-8-,17-9+ |
| InChIKey | MEDQWZKTJXXNRM-VAQFQWRASA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one?
The IUPAC name of (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one (CID 2392104) is (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one.
What is the SMILES notation for (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one?
The canonical SMILES for (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one is CCCN1C/C(=C/c2ccsc2)C(=O)/C(=C/c2ccsc2)C1.
What is the InChIKey of (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one?
The InChIKey is MEDQWZKTJXXNRM-VAQFQWRASA-N. The full InChI is InChI=1S/C18H19NOS2/c1-2-5-19-10-16(8-14-3-6-21-12-14)18(20)17(11-19)9-15-4-7-22-13-15/h3-4,6-9,12-13H,2,5,10-11H2,1H3/b16-8-,17-9+.
What are the key properties of (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one?
(3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one has a molecular weight of 329.49 g/mol, XLogP of 4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-1-propyl-3,5-bis(thiophen-3-ylmethylidene)piperidin-4-one is sourced from PubChem (CID 2392104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).