C21H23NO5 — CID 2392118
[(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 2392118) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2392118 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCc1ccc(NC(=O)[C@H](C)OC(=O)/C=C/c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-4-15-5-9-17(10-6-15)22-21(25)14(2)27-20(24)12-8-16-7-11-18(23)19(13-16)26-3/h5-14,23H,4H2,1-3H3,(H,22,25)/b12-8+/t14-/m0/s1 |
| InChIKey | RXJBVUDEZMPHEV-BCNIOPEESA-N |
| XLogP | 3.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|