C12H11ClN2OS — CID 2392260
2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide (PubChem CID 2392260) has the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. Its IUPAC name is 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide.
| Compound Name | 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 2392260 |
| Molecular Formula | C12H11ClN2OS |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
| SMILES | Cc1csc(N(C(=O)CCl)c2ccccc2)n1 |
| InChI | InChI=1S/C12H11ClN2OS/c1-9-8-17-12(14-9)15(11(16)7-13)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | ANTVEXRUHJVROA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|