C31H43BrN2O6 — CID 23922814
ethyl (5R,6R,7S)-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23922814) has the molecular formula C31H43BrN2O6 and a molecular weight of 619.60 g/mol. Its IUPAC name is ethyl (5R,6R,7S)-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6R,7S)-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23922814 |
| Molecular Formula | C31H43BrN2O6 |
| Molecular Weight | 619.60 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | ethyl (5R,6R,7S)-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N([C@H](CO)c2ccccc2)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@@H]3OC12CC3Br)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C31H43BrN2O6/c1-8-15-33(30(6,7)18-29(3,4)5)27(37)25-31-16-20(32)24(40-31)22(28(38)39-9-2)23(31)26(36)34(25)21(17-35)19-13-11-10-12-14-19/h8,10-14,20-25,35H,1,9,15-18H2,2-7H3/t20?,21-,22-,23+,24-,25?,31?/m1/s1 |
| InChIKey | DLBQMVCVRXIHCV-KAPFDTOOSA-N |
| XLogP | 4.26 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|