About N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide
N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide (PubChem CID 2392313) has the molecular formula C5H4BrClN2OS
and a molecular weight of 255.52 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide.
Molecular Properties
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide |
| PubChem CID | 2392313 |
| Molecular Formula | C5H4BrClN2OS |
| Molecular Weight | 255.52 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C5H4BrClN2OS/c6-3-2-8-5(11-3)9-4(10)1-7/h2H,1H2,(H,8,9,10) |
| InChIKey | DRUYVFJOLFMSOA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide?
The IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide (CID 2392313) is N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide.
What is the SMILES notation for N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide?
The canonical SMILES for N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide is O=C(CCl)Nc1ncc(Br)s1.
What is the InChIKey of N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide?
The InChIKey is DRUYVFJOLFMSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrClN2OS/c6-3-2-8-5(11-3)9-4(10)1-7/h2H,1H2,(H,8,9,10).
What are the key properties of N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide?
N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide has a molecular weight of 255.52 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-1,3-thiazol-2-yl)-2-chloroacetamide is sourced from PubChem (CID 2392313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).