C29H46N2O5S — CID 23923608
pent-4-enyl (5S,6S,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23923608) has the molecular formula C29H46N2O5S and a molecular weight of 534.76 g/mol. Its IUPAC name is pent-4-enyl (5S,6S,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5S,6S,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23923608 |
| Molecular Formula | C29H46N2O5S |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | pent-4-enyl (5S,6S,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)CCCC)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C29H46N2O5S/c1-5-8-14-21-36-27(35)23-22-25(33)31(19-12-10-11-13-20-32)24(29(22)16-15-28(23,4)37-29)26(34)30(17-7-3)18-9-6-2/h5,7,22-24,32H,1,3,6,8-21H2,2,4H3/t22-,23-,24?,28+,29?/m0/s1 |
| InChIKey | DNSQXIZSMBVWKC-PFINFNDISA-N |
| XLogP | 4.34 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|