C24H38N2O5S — CID 23923732
(5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23923732) has the molecular formula C24H38N2O5S and a molecular weight of 466.64 g/mol. Its IUPAC name is (5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23923732 |
| Molecular Formula | C24H38N2O5S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)[C@@H](C)CC)C(=O)[C@@H]2[C@H](C(=O)O)[C@@H]3CC(C)C12S3)C(C)(C)C |
| InChI | InChI=1S/C24H38N2O5S/c1-8-10-25(23(5,6)7)21(29)19-24-14(4)11-16(32-24)17(22(30)31)18(24)20(28)26(19)15(12-27)13(3)9-2/h8,13-19,27H,1,9-12H2,2-7H3,(H,30,31)/t13-,14?,15-,16-,17+,18-,19?,24?/m0/s1 |
| InChIKey | DCIMFUNATSPQNP-PFORDVKASA-N |
| XLogP | 2.63 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|