About 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol
2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol (PubChem CID 2392717) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol.
Molecular Properties
| Compound Name | 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol |
| PubChem CID | 2392717 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol |
| SMILES | C=C(NN1[C@H](C)CCC[C@@H]1C)c1ccccc1O |
| InChI | InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)17(11)16-13(3)14-9-4-5-10-15(14)18/h4-5,9-12,16,18H,3,6-8H2,1-2H3/t11-,12+ |
| InChIKey | VBGWDPLYYUHVAE-TXEJJXNPSA-N |
| XLogP | 3.13 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol?
The IUPAC name of 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol (CID 2392717) is 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol.
What is the SMILES notation for 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol?
The canonical SMILES for 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol is C=C(NN1[C@H](C)CCC[C@@H]1C)c1ccccc1O.
What is the InChIKey of 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol?
The InChIKey is VBGWDPLYYUHVAE-TXEJJXNPSA-N. The full InChI is InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)17(11)16-13(3)14-9-4-5-10-15(14)18/h4-5,9-12,16,18H,3,6-8H2,1-2H3/t11-,12+.
What are the key properties of 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol?
2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol has a molecular weight of 246.35 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[[(2R,6S)-2,6-dimethylpiperidin-1-yl]amino]ethenyl]phenol is sourced from PubChem (CID 2392717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).