C36H43N3O7 — CID 23927960
[(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23927960) has the molecular formula C36H43N3O7 and a molecular weight of 629.75 g/mol. Its IUPAC name is [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23927960 |
| Molecular Formula | C36H43N3O7 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)NC[C@H](C)OC(=O)[C@@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C36H43N3O7/c1-4-6-17-29(41)37-21-24(3)45-35(44)30-28-18-19-36(46-28)31(30)33(42)39(27(23-40)26-15-11-8-12-16-26)32(36)34(43)38(20-5-2)22-25-13-9-7-10-14-25/h4-5,7-16,24,27-28,30-32,40H,1-2,6,17-23H2,3H3,(H,37,41)/t24-,27+,28+,30-,31-,32+,36-/m0/s1 |
| InChIKey | XJYVNADENZFQBS-CGEXAERKSA-N |
| XLogP | 3.32 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|