C15H22O5 — CID 23928031
(5R,5aS,8S,9aS,9bS)-5,8,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one (PubChem CID 23928031) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (5R,5aS,8S,9aS,9bS)-5,8,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one.
| Compound Name | (5R,5aS,8S,9aS,9bS)-5,8,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 23928031 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (5R,5aS,8S,9aS,9bS)-5,8,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one |
| SMILES | CC1(C)C[C@H](O)C[C@@]2(C)[C@H]1[C@H](O)C=C1COC(=O)[C@@]12O |
| InChI | InChI=1S/C15H22O5/c1-13(2)5-9(16)6-14(3)11(13)10(17)4-8-7-20-12(18)15(8,14)19/h4,9-11,16-17,19H,5-7H2,1-3H3/t9-,10+,11-,14-,15-/m0/s1 |
| InChIKey | VCSXCHXOFPVNGS-TVMMDAIPSA-N |
| XLogP | 0.38 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|