C34H32N4O3 — CID 23928559
1-[4-[(E,1R,2S)-6-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]benzo[cd]indol-2-one (PubChem CID 23928559) has the molecular formula C34H32N4O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is 1-[4-[(E,1R,2S)-6-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]benzo[cd]indol-2-one.
| Compound Name | 1-[4-[(E,1R,2S)-6-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 23928559 |
| Molecular Formula | C34H32N4O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 1-[4-[(E,1R,2S)-6-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]benzo[cd]indol-2-one |
| SMILES | CO[C@@H](c1ccc(N2C(=O)c3cccc4cccc2c34)cc1)[C@@H](C)/C=C/CCn1cc([C@H](O)c2ccccc2)nn1 |
| InChI | InChI=1S/C34H32N4O3/c1-23(10-6-7-21-37-22-29(35-36-37)32(39)25-11-4-3-5-12-25)33(41-2)26-17-19-27(20-18-26)38-30-16-9-14-24-13-8-15-28(31(24)30)34(38)40/h3-6,8-20,22-23,32-33,39H,7,21H2,1-2H3/b10-6+/t23-,32+,33+/m0/s1 |
| InChIKey | BERFDFUSPBSQCM-UVVUZXJESA-N |
| XLogP | 6.78 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|