C23H32FNO4Si — CID 23929810
1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3-methoxypyridin-2-one (PubChem CID 23929810) has the molecular formula C23H32FNO4Si and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3-methoxypyridin-2-one.
| Compound Name | 1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3-methoxypyridin-2-one |
|---|---|
| PubChem CID | 23929810 |
| Molecular Formula | C23H32FNO4Si |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[4-[2-[(2S,3R,4S,5R)-4-[fluoro(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]-3-methoxypyridin-2-one |
| SMILES | COc1cccn(-c2ccc(CC[C@@H]3O[C@H](CCO)[C@@H]([Si](C)(C)F)[C@@H]3C)cc2)c1=O |
| InChI | InChI=1S/C23H32FNO4Si/c1-16-19(29-20(13-15-26)22(16)30(3,4)24)12-9-17-7-10-18(11-8-17)25-14-5-6-21(28-2)23(25)27/h5-8,10-11,14,16,19-20,22,26H,9,12-13,15H2,1-4H3/t16-,19+,20-,22+/m1/s1 |
| InChIKey | LBLUVDSIVCVPKH-QEMXTEJRSA-N |
| XLogP | 4.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|