C31H33N3O4 — CID 23930350
2-[4-[(E,1S,2R)-6-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-1-methoxy-2-methyl-6-oxohex-3-enyl]phenyl]-1H-indazol-3-one (PubChem CID 23930350) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-[4-[(E,1S,2R)-6-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-1-methoxy-2-methyl-6-oxohex-3-enyl]phenyl]-1H-indazol-3-one.
| Compound Name | 2-[4-[(E,1S,2R)-6-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-1-methoxy-2-methyl-6-oxohex-3-enyl]phenyl]-1H-indazol-3-one |
|---|---|
| PubChem CID | 23930350 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 2-[4-[(E,1S,2R)-6-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-1-methoxy-2-methyl-6-oxohex-3-enyl]phenyl]-1H-indazol-3-one |
| SMILES | CO[C@H](c1ccc(-n2[nH]c3ccccc3c2=O)cc1)[C@H](C)/C=C/CC(=O)N1Cc2ccccc2C[C@H]1CO |
| InChI | InChI=1S/C31H33N3O4/c1-21(8-7-13-29(36)33-19-24-10-4-3-9-23(24)18-26(33)20-35)30(38-2)22-14-16-25(17-15-22)34-31(37)27-11-5-6-12-28(27)32-34/h3-12,14-17,21,26,30,32,35H,13,18-20H2,1-2H3/b8-7+/t21-,26+,30+/m1/s1 |
| InChIKey | LOSACGLAXMQNTN-UXXYIAGXSA-N |
| XLogP | 4.53 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|