C36H41N3O6 — CID 23930510
N-benzyl-2-[(2'R,3R,3'S,4'S)-1-benzyl-3'-(2-hydroxypropan-2-yl)-4'-methyl-2-oxo-5-(2-oxoazetidin-1-yl)spiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23930510) has the molecular formula C36H41N3O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is N-benzyl-2-[(2'R,3R,3'S,4'S)-1-benzyl-3'-(2-hydroxypropan-2-yl)-4'-methyl-2-oxo-5-(2-oxoazetidin-1-yl)spiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2'R,3R,3'S,4'S)-1-benzyl-3'-(2-hydroxypropan-2-yl)-4'-methyl-2-oxo-5-(2-oxoazetidin-1-yl)spiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23930510 |
| Molecular Formula | C36H41N3O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | N-benzyl-2-[(2'R,3R,3'S,4'S)-1-benzyl-3'-(2-hydroxypropan-2-yl)-4'-methyl-2-oxo-5-(2-oxoazetidin-1-yl)spiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@H]1[C@H](C(C)(C)O)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@]12C(=O)N(Cc1ccccc1)c1ccc(N3CCC3=O)cc12 |
| InChI | InChI=1S/C36H41N3O6/c1-24-33(35(2,3)44)30(21-32(42)37(18-19-40)22-25-10-6-4-7-11-25)45-36(24)28-20-27(38-17-16-31(38)41)14-15-29(28)39(34(36)43)23-26-12-8-5-9-13-26/h4-15,20,24,30,33,40,44H,16-19,21-23H2,1-3H3/t24-,30+,33-,36+/m0/s1 |
| InChIKey | PCOQBENADSGTLS-PVBFUHCJSA-N |
| XLogP | 4.00 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |