About 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one
1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one (PubChem CID 2393063) has the molecular formula C15H12F2N2OS2
and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 2393063 |
| Molecular Formula | C15H12F2N2OS2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2c(c1C)c(=O)n(-c1ccccc1)c(=S)n2C(F)F |
| InChI | InChI=1S/C15H12F2N2OS2/c1-8-9(2)22-13-11(8)12(20)18(10-6-4-3-5-7-10)15(21)19(13)14(16)17/h3-7,14H,1-2H3 |
| InChIKey | NCBWLAXTDHAUAX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one (CID 2393063) is 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one is Cc1sc2c(c1C)c(=O)n(-c1ccccc1)c(=S)n2C(F)F.
What is the InChIKey of 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one?
The InChIKey is NCBWLAXTDHAUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2OS2/c1-8-9(2)22-13-11(8)12(20)18(10-6-4-3-5-7-10)15(21)19(13)14(16)17/h3-7,14H,1-2H3.
What are the key properties of 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one?
1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one has a molecular weight of 338.40 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-5,6-dimethyl-3-phenyl-2-sulfanylidenethieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 2393063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).