C14H14N2O4S — CID 23930670
(1S,9S,16S)-9,16-bis(hydroxymethyl)-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one (PubChem CID 23930670) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is (1S,9S,16S)-9,16-bis(hydroxymethyl)-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one.
| Compound Name | (1S,9S,16S)-9,16-bis(hydroxymethyl)-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
|---|---|
| PubChem CID | 23930670 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (1S,9S,16S)-9,16-bis(hydroxymethyl)-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
| SMILES | O=C1CSC2=N[C@]3(CO)Oc4ccccc4[C@H]([C@H]3CO)N12 |
| InChI | InChI=1S/C14H14N2O4S/c17-5-9-12-8-3-1-2-4-10(8)20-14(9,7-18)15-13-16(12)11(19)6-21-13/h1-4,9,12,17-18H,5-7H2/t9-,12-,14-/m1/s1 |
| InChIKey | WALYQZNCUAUDJE-GAJTVXKRSA-N |
| XLogP | 0.36 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |