C21H14N4O2 — CID 23931103
8-methyl-13-(3-methylphenyl)-12,14-dioxo-1,8,13-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15)-pentaene-10-carbonitrile (PubChem CID 23931103) has the molecular formula C21H14N4O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 8-methyl-13-(3-methylphenyl)-12,14-dioxo-1,8,13-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15)-pentaene-10-carbonitrile.
| Compound Name | 8-methyl-13-(3-methylphenyl)-12,14-dioxo-1,8,13-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15)-pentaene-10-carbonitrile |
|---|---|
| PubChem CID | 23931103 |
| Molecular Formula | C21H14N4O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 8-methyl-13-(3-methylphenyl)-12,14-dioxo-1,8,13-triazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,11(15)-pentaene-10-carbonitrile |
| SMILES | Cc1cccc(N2C(=O)c3c(C#N)c4n(C)c5ccccc5n4c3C2=O)c1 |
| InChI | InChI=1S/C21H14N4O2/c1-12-6-5-7-13(10-12)24-20(26)17-14(11-22)19-23(2)15-8-3-4-9-16(15)25(19)18(17)21(24)27/h3-10H,1-2H3 |
| InChIKey | ALMHLEXWAZUMLJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|