C21H25Cl2N3S — CID 23931715
1-(1-benzylpyrrolidin-3-yl)-3-[(3,4-dichlorophenyl)methyl]-1-ethylthiourea (PubChem CID 23931715) has the molecular formula C21H25Cl2N3S and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-3-yl)-3-[(3,4-dichlorophenyl)methyl]-1-ethylthiourea.
| Compound Name | 1-(1-benzylpyrrolidin-3-yl)-3-[(3,4-dichlorophenyl)methyl]-1-ethylthiourea |
|---|---|
| PubChem CID | 23931715 |
| Molecular Formula | C21H25Cl2N3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-(1-benzylpyrrolidin-3-yl)-3-[(3,4-dichlorophenyl)methyl]-1-ethylthiourea |
| SMILES | CCN(C(=S)NCc1ccc(Cl)c(Cl)c1)C1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H25Cl2N3S/c1-2-26(21(27)24-13-17-8-9-19(22)20(23)12-17)18-10-11-25(15-18)14-16-6-4-3-5-7-16/h3-9,12,18H,2,10-11,13-15H2,1H3,(H,24,27) |
| InChIKey | MWTZZUPPYGIPCH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|