C25H17ClFN7O5 — CID 23932625
N-[2-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]-5-methylpyrazol-3-yl]-3,5-dinitrobenzamide (PubChem CID 23932625) has the molecular formula C25H17ClFN7O5 and a molecular weight of 549.91 g/mol. Its IUPAC name is N-[2-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]-5-methylpyrazol-3-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]-5-methylpyrazol-3-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 23932625 |
| Molecular Formula | C25H17ClFN7O5 |
| Molecular Weight | 549.91 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | N-[2-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]-5-methylpyrazol-3-yl]-3,5-dinitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)n(-c2nc3ccccc3n2Cc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C25H17ClFN7O5/c1-14-9-23(29-24(35)15-10-16(33(36)37)12-17(11-15)34(38)39)32(30-14)25-28-21-7-2-3-8-22(21)31(25)13-18-19(26)5-4-6-20(18)27/h2-12H,13H2,1H3,(H,29,35) |
| InChIKey | JXBFMWJXURQORG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|