C27H27N5OS — CID 2393302
8-[methyl-(1-methylpiperidin-4-yl)amino]-13-(4-methylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one (PubChem CID 2393302) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is 8-[methyl-(1-methylpiperidin-4-yl)amino]-13-(4-methylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one.
| Compound Name | 8-[methyl-(1-methylpiperidin-4-yl)amino]-13-(4-methylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| PubChem CID | 2393302 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 8-[methyl-(1-methylpiperidin-4-yl)amino]-13-(4-methylphenyl)-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
| SMILES | Cc1ccc(-c2csc3nc4c5ccccc5c(N(C)C5CCN(C)CC5)nn4c(=O)c23)cc1 |
| InChI | InChI=1S/C27H27N5OS/c1-17-8-10-18(11-9-17)22-16-34-26-23(22)27(33)32-24(28-26)20-6-4-5-7-21(20)25(29-32)31(3)19-12-14-30(2)15-13-19/h4-11,16,19H,12-15H2,1-3H3 |
| InChIKey | IENILGVTWAAVOB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|