C22H26N6O3S3 — CID 23933453
2-[[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23933453) has the molecular formula C22H26N6O3S3 and a molecular weight of 518.69 g/mol. Its IUPAC name is 2-[[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23933453 |
| Molecular Formula | C22H26N6O3S3 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-[[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(CSc2nc3sc4c(c3c(=O)[nH]2)CCCC4)nnc1SCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H26N6O3S3/c1-2-7-28-16(25-26-22(28)33-13-17(29)27-8-10-31-11-9-27)12-32-21-23-19(30)18-14-5-3-4-6-15(14)34-20(18)24-21/h2H,1,3-13H2,(H,23,24,30) |
| InChIKey | OYZDCIRCGHNBGV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|