About 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one
2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 23933548) has the molecular formula C14H21N3O
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
Molecular Properties
| Compound Name | 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| PubChem CID | 23933548 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | CCCCc1nc(N)nc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C14H21N3O/c1-4-5-6-9-12-10(17-13(15)16-9)7-14(2,3)8-11(12)18/h4-8H2,1-3H3,(H2,15,16,17) |
| InChIKey | XBGWNXVJTNMJRP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
The IUPAC name of 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one (CID 23933548) is 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
What is the SMILES notation for 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
The canonical SMILES for 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one is CCCCc1nc(N)nc2c1C(=O)CC(C)(C)C2.
What is the InChIKey of 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
The InChIKey is XBGWNXVJTNMJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O/c1-4-5-6-9-12-10(17-13(15)16-9)7-14(2,3)8-11(12)18/h4-8H2,1-3H3,(H2,15,16,17).
What are the key properties of 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one?
2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one has a molecular weight of 247.34 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-butyl-7,7-dimethyl-6,8-dihydroquinazolin-5-one is sourced from PubChem (CID 23933548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).