C26H30N4O4S — CID 23933569
[4-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]-(3-methoxy-2-nitrophenyl)methanone (PubChem CID 23933569) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is [4-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]-(3-methoxy-2-nitrophenyl)methanone.
| Compound Name | [4-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]-(3-methoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 23933569 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | [4-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]piperidin-1-yl]-(3-methoxy-2-nitrophenyl)methanone |
| SMILES | CCN(CC)c1ccc(-c2csc(C3CCN(C(=O)c4cccc(OC)c4[N+](=O)[O-])CC3)n2)cc1 |
| InChI | InChI=1S/C26H30N4O4S/c1-4-28(5-2)20-11-9-18(10-12-20)22-17-35-25(27-22)19-13-15-29(16-14-19)26(31)21-7-6-8-23(34-3)24(21)30(32)33/h6-12,17,19H,4-5,13-16H2,1-3H3 |
| InChIKey | XETKYWJSTYPKGZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|