About N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine
N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine (PubChem CID 23934163) has the molecular formula C19H16N4O4S
and a molecular weight of 396.43 g/mol. Its IUPAC name is N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine |
| PubChem CID | 23934163 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccccc2)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H16N4O4S/c1-2-20-19-22(16(11-28-19)13-6-4-3-5-7-13)21-10-14-8-17-18(27-12-26-17)9-15(14)23(24)25/h3-11H,2,12H2,1H3/b20-19-,21-10? |
| InChIKey | ZECDUISNVXWUHU-KQVUUHHTSA-N |
| XLogP | 3.66 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine?
The IUPAC name of N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine (CID 23934163) is N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine.
What is the SMILES notation for N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine?
The canonical SMILES for N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine is CC/N=c1\scc(-c2ccccc2)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2.
What is the InChIKey of N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine?
The InChIKey is ZECDUISNVXWUHU-KQVUUHHTSA-N. The full InChI is InChI=1S/C19H16N4O4S/c1-2-20-19-22(16(11-28-19)13-6-4-3-5-7-13)21-10-14-8-17-18(27-12-26-17)9-15(14)23(24)25/h3-11H,2,12H2,1H3/b20-19-,21-10?.
What are the key properties of N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine?
N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine has a molecular weight of 396.43 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine is sourced from PubChem (CID 23934163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).