C10H18N4O2 — CID 2393504
6-amino-1-butyl-5-(ethylamino)pyrimidine-2,4-dione (PubChem CID 2393504) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 6-amino-1-butyl-5-(ethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-(ethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2393504 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 6-amino-1-butyl-5-(ethylamino)pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(NCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H18N4O2/c1-3-5-6-14-8(11)7(12-4-2)9(15)13-10(14)16/h12H,3-6,11H2,1-2H3,(H,13,15,16) |
| InChIKey | PBVLBCUSOSAXLM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |