C18H15N3O2S — CID 23936331
2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)benzonitrile (PubChem CID 23936331) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)benzonitrile.
| Compound Name | 2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)benzonitrile |
|---|---|
| PubChem CID | 23936331 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)benzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H15N3O2S/c19-11-13-5-1-4-8-18(13)24(22,23)21-10-9-15-14-6-2-3-7-16(14)20-17(15)12-21/h1-8,20H,9-10,12H2 |
| InChIKey | MWNTUEOQHXCPAE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|