C28H27N3O2S — CID 23936372
4-(3-nitrophenyl)-N-(2-propan-2-ylphenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine (PubChem CID 23936372) has the molecular formula C28H27N3O2S and a molecular weight of 469.61 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-N-(2-propan-2-ylphenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine.
| Compound Name | 4-(3-nitrophenyl)-N-(2-propan-2-ylphenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23936372 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-(3-nitrophenyl)-N-(2-propan-2-ylphenyl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine |
| SMILES | CC(C)c1ccccc1/N=c1\scc(-c2cccc([N+](=O)[O-])c2)n1C1CCCc2ccccc21 |
| InChI | InChI=1S/C28H27N3O2S/c1-19(2)23-13-5-6-15-25(23)29-28-30(26-16-8-10-20-9-3-4-14-24(20)26)27(18-34-28)21-11-7-12-22(17-21)31(32)33/h3-7,9,11-15,17-19,26H,8,10,16H2,1-2H3/b29-28- |
| InChIKey | CGKPIKDHIAGFRT-ZIADKAODSA-N |
| XLogP | 7.41 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|