About N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine
N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23936506) has the molecular formula C19H12F2N4S2
and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| PubChem CID | 23936506 |
| Molecular Formula | C19H12F2N4S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3cccs3)n2N=Cc2ccccn2)c(F)c1 |
| InChI | InChI=1S/C19H12F2N4S2/c20-13-6-7-16(15(21)10-13)24-19-25(23-11-14-4-1-2-8-22-14)17(12-27-19)18-5-3-9-26-18/h1-12H/b23-11?,24-19- |
| InChIKey | GABJIJOGHDFAGZ-RGYWNEAYSA-N |
| XLogP | 5.07 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine?
The IUPAC name of N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine (CID 23936506) is N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine.
What is the SMILES notation for N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine?
The canonical SMILES for N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine is Fc1ccc(/N=c2\scc(-c3cccs3)n2N=Cc2ccccn2)c(F)c1.
What is the InChIKey of N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine?
The InChIKey is GABJIJOGHDFAGZ-RGYWNEAYSA-N. The full InChI is InChI=1S/C19H12F2N4S2/c20-13-6-7-16(15(21)10-13)24-19-25(23-11-14-4-1-2-8-22-14)17(12-27-19)18-5-3-9-26-18/h1-12H/b23-11?,24-19-.
What are the key properties of N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine?
N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine has a molecular weight of 398.46 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-3-(pyridin-2-ylmethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine is sourced from PubChem (CID 23936506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).