C17H15ClN2O5S — CID 23937341
dimethyl 4-(2-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-3,6-dicarboxylate (PubChem CID 23937341) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is dimethyl 4-(2-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-3,6-dicarboxylate.
| Compound Name | dimethyl 4-(2-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 23937341 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | dimethyl 4-(2-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-3,6-dicarboxylate |
| SMILES | COC(=O)C1C(=O)NC2=C(C(=S)N(C(=O)OC)C2)C1c1ccccc1Cl |
| InChI | InChI=1S/C17H15ClN2O5S/c1-24-16(22)13-11(8-5-3-4-6-9(8)18)12-10(19-14(13)21)7-20(15(12)26)17(23)25-2/h3-6,11,13H,7H2,1-2H3,(H,19,21) |
| InChIKey | BHQDUHCECZEDTM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|