About (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate
(2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate (PubChem CID 2393742) has the molecular formula C17H13NO3S
and a molecular weight of 311.36 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate |
| PubChem CID | 2393742 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1ccccc1O |
| InChI | InChI=1S/C17H13NO3S/c19-15-9-5-4-8-14(15)17(20)21-10-13-11-22-16(18-13)12-6-2-1-3-7-12/h1-9,11,19H,10H2 |
| InChIKey | AZWZWJWKZKCJKA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate (CID 2393742) is (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate is O=C(OCc1csc(-c2ccccc2)n1)c1ccccc1O.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate?
The InChIKey is AZWZWJWKZKCJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3S/c19-15-9-5-4-8-14(15)17(20)21-10-13-11-22-16(18-13)12-6-2-1-3-7-12/h1-9,11,19H,10H2.
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate?
(2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate has a molecular weight of 311.36 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)methyl 2-hydroxybenzoate is sourced from PubChem (CID 2393742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).