C30H29NO3 — CID 23937506
phenacyl 2-(5-tert-butyl-2,3-dimethylphenyl)quinoline-4-carboxylate (PubChem CID 23937506) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is phenacyl 2-(5-tert-butyl-2,3-dimethylphenyl)quinoline-4-carboxylate.
| Compound Name | phenacyl 2-(5-tert-butyl-2,3-dimethylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23937506 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | phenacyl 2-(5-tert-butyl-2,3-dimethylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2cc(C(=O)OCC(=O)c3ccccc3)c3ccccc3n2)c1C |
| InChI | InChI=1S/C30H29NO3/c1-19-15-22(30(3,4)5)16-24(20(19)2)27-17-25(23-13-9-10-14-26(23)31-27)29(33)34-18-28(32)21-11-7-6-8-12-21/h6-17H,18H2,1-5H3 |
| InChIKey | ZWPFUMUOTRTJBS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |