C20H12ClNO3 — CID 23938408
6-(5-chloro-2-hydroxyphenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 23938408) has the molecular formula C20H12ClNO3 and a molecular weight of 349.77 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyphenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-(5-chloro-2-hydroxyphenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 23938408 |
| Molecular Formula | C20H12ClNO3 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 6-(5-chloro-2-hydroxyphenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1cc(Cl)ccc1O)CC3 |
| InChI | InChI=1S/C20H12ClNO3/c21-12-5-8-16(23)15(9-12)22-19(24)13-6-3-10-1-2-11-4-7-14(20(22)25)18(13)17(10)11/h3-9,23H,1-2H2 |
| InChIKey | PQQHEVRCTKWMOA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|