About (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one
(2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 23941129) has the molecular formula C15H11NO4
and a molecular weight of 269.26 g/mol. Its IUPAC name is (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one |
| PubChem CID | 23941129 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2ccccc2O[C@H](c2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11NO4/c17-14-11-8-4-5-9-12(11)20-15(13(14)16(18)19)10-6-2-1-3-7-10/h1-9,13,15H/t13-,15+/m0/s1 |
| InChIKey | HCQGZTMBXKVAEF-DZGCQCFKSA-N |
| XLogP | 2.65 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one?
The IUPAC name of (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one (CID 23941129) is (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one?
The canonical SMILES for (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one is O=C1c2ccccc2O[C@H](c2ccccc2)[C@H]1[N+](=O)[O-].
What is the InChIKey of (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one?
The InChIKey is HCQGZTMBXKVAEF-DZGCQCFKSA-N. The full InChI is InChI=1S/C15H11NO4/c17-14-11-8-4-5-9-12(11)20-15(13(14)16(18)19)10-6-2-1-3-7-10/h1-9,13,15H/t13-,15+/m0/s1.
What are the key properties of (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one?
(2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one has a molecular weight of 269.26 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-nitro-2-phenyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 23941129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).