About 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide (PubChem CID 2394115) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide |
| PubChem CID | 2394115 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)CN1C(=O)NC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C13H21N3O3/c1-2-14-10(17)9-16-11(18)13(15-12(16)19)7-5-3-4-6-8-13/h2-9H2,1H3,(H,14,17)(H,15,19) |
| InChIKey | ZXZHYIMZTJCTRZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide?
The IUPAC name of 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide (CID 2394115) is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide.
What is the SMILES notation for 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide?
The canonical SMILES for 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide is CCNC(=O)CN1C(=O)NC2(CCCCCC2)C1=O.
What is the InChIKey of 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide?
The InChIKey is ZXZHYIMZTJCTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-2-14-10(17)9-16-11(18)13(15-12(16)19)7-5-3-4-6-8-13/h2-9H2,1H3,(H,14,17)(H,15,19).
What are the key properties of 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide?
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide has a molecular weight of 267.33 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-ethylacetamide is sourced from PubChem (CID 2394115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).