C14H13N5OS2 — CID 23942262
6-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide (PubChem CID 23942262) has the molecular formula C14H13N5OS2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 6-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide.
| Compound Name | 6-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 23942262 |
| Molecular Formula | C14H13N5OS2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 6-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2sc3nc4c(cc3c2N)CCC4)s1 |
| InChI | InChI=1S/C14H13N5OS2/c1-6-18-19-14(21-6)17-12(20)11-10(15)8-5-7-3-2-4-9(7)16-13(8)22-11/h5H,2-4,15H2,1H3,(H,17,19,20) |
| InChIKey | ONUVKVJIZGANGZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |