C27H26N4O5S — CID 23942554
2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide (PubChem CID 23942554) has the molecular formula C27H26N4O5S and a molecular weight of 518.60 g/mol. Its IUPAC name is 2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide.
| Compound Name | 2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 23942554 |
| Molecular Formula | C27H26N4O5S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide |
| SMILES | COc1ccc(-c2nc(SC(C)C(=O)Nc3cc([N+](=O)[O-])ccc3C)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H26N4O5S/c1-16-5-10-20(31(33)34)15-23(16)28-26(32)17(2)37-27-29-24(18-6-11-21(35-3)12-7-18)25(30-27)19-8-13-22(36-4)14-9-19/h5-15,17H,1-4H3,(H,28,32)(H,29,30) |
| InChIKey | DTPKFXKECASOML-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|