C18H20N2O5 — CID 23944221
[1-(2,4-dimethoxyanilino)-1-oxobutan-2-yl] pyridine-4-carboxylate (PubChem CID 23944221) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is [1-(2,4-dimethoxyanilino)-1-oxobutan-2-yl] pyridine-4-carboxylate.
| Compound Name | [1-(2,4-dimethoxyanilino)-1-oxobutan-2-yl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 23944221 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [1-(2,4-dimethoxyanilino)-1-oxobutan-2-yl] pyridine-4-carboxylate |
| SMILES | CCC(OC(=O)c1ccncc1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H20N2O5/c1-4-15(25-18(22)12-7-9-19-10-8-12)17(21)20-14-6-5-13(23-2)11-16(14)24-3/h5-11,15H,4H2,1-3H3,(H,20,21) |
| InChIKey | UIGLNQXFTKEKPM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |