C26H25N3O3S2 — CID 23944860
ethyl 2-[(3-amino-6-propylthieno[2,3-b]pyridine-2-carbonyl)amino]-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate (PubChem CID 23944860) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is ethyl 2-[(3-amino-6-propylthieno[2,3-b]pyridine-2-carbonyl)amino]-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate.
| Compound Name | ethyl 2-[(3-amino-6-propylthieno[2,3-b]pyridine-2-carbonyl)amino]-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate |
|---|---|
| PubChem CID | 23944860 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | ethyl 2-[(3-amino-6-propylthieno[2,3-b]pyridine-2-carbonyl)amino]-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate |
| SMILES | CCCc1ccc2c(N)c(C(=O)Nc3sc4c(c3C(=O)OCC)-c3ccccc3CC4)sc2n1 |
| InChI | InChI=1S/C26H25N3O3S2/c1-3-7-15-11-12-17-21(27)22(34-24(17)28-15)23(30)29-25-20(26(31)32-4-2)19-16-9-6-5-8-14(16)10-13-18(19)33-25/h5-6,8-9,11-12H,3-4,7,10,13,27H2,1-2H3,(H,29,30) |
| InChIKey | CMHFHKBUCSYGAS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|