C26H21Cl3N4O2 — CID 23944989
2'-amino-6-chloro-1'-(3,5-dichlorophenyl)-7,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile (PubChem CID 23944989) has the molecular formula C26H21Cl3N4O2 and a molecular weight of 527.84 g/mol. Its IUPAC name is 2'-amino-6-chloro-1'-(3,5-dichlorophenyl)-7,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile.
| Compound Name | 2'-amino-6-chloro-1'-(3,5-dichlorophenyl)-7,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
|---|---|
| PubChem CID | 23944989 |
| Molecular Formula | C26H21Cl3N4O2 |
| Molecular Weight | 527.84 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 2'-amino-6-chloro-1'-(3,5-dichlorophenyl)-7,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)C21C(C#N)=C(N)N(c2cc(Cl)cc(Cl)c2)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H21Cl3N4O2/c1-12-18(29)5-4-16-22(12)32-24(35)26(16)17(11-30)23(31)33(15-7-13(27)6-14(28)8-15)19-9-25(2,3)10-20(34)21(19)26/h4-8H,9-10,31H2,1-3H3,(H,32,35) |
| InChIKey | BNAFJUZJHOMUAV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |