About 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide
1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide (PubChem CID 23945501) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide.
Molecular Properties
| Compound Name | 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide |
| PubChem CID | 23945501 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1nc2ccccc2n1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c1-3-21(4-2)19(24)17-20-15-12-8-9-13-16(15)22(17)18(23)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | MYYHAYHPCXNRGJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide?
The IUPAC name of 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide (CID 23945501) is 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide.
What is the SMILES notation for 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide?
The canonical SMILES for 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide is CCN(CC)C(=O)c1nc2ccccc2n1C(=O)c1ccccc1.
What is the InChIKey of 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide?
The InChIKey is MYYHAYHPCXNRGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2/c1-3-21(4-2)19(24)17-20-15-12-8-9-13-16(15)22(17)18(23)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3.
What are the key properties of 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide?
1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide has a molecular weight of 321.38 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzoyl-N,N-diethylbenzimidazole-2-carboxamide is sourced from PubChem (CID 23945501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).