About 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol
4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol (PubChem CID 23946780) has the molecular formula C15H17FO2
and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol.
Molecular Properties
| Compound Name | 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol |
| PubChem CID | 23946780 |
| Molecular Formula | C15H17FO2 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol |
| SMILES | C/C(=C\c1ccc(O)c(F)c1)CC[C@@H]1C=CCO1 |
| InChI | InChI=1S/C15H17FO2/c1-11(4-6-13-3-2-8-18-13)9-12-5-7-15(17)14(16)10-12/h2-3,5,7,9-10,13,17H,4,6,8H2,1H3/b11-9+/t13-/m0/s1 |
| InChIKey | JKSIPJDVMHIAPB-STRFDMGBSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol?
The IUPAC name of 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol (CID 23946780) is 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol.
What is the SMILES notation for 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol?
The canonical SMILES for 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol is C/C(=C\c1ccc(O)c(F)c1)CC[C@@H]1C=CCO1.
What is the InChIKey of 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol?
The InChIKey is JKSIPJDVMHIAPB-STRFDMGBSA-N. The full InChI is InChI=1S/C15H17FO2/c1-11(4-6-13-3-2-8-18-13)9-12-5-7-15(17)14(16)10-12/h2-3,5,7,9-10,13,17H,4,6,8H2,1H3/b11-9+/t13-/m0/s1.
What are the key properties of 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol?
4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol has a molecular weight of 248.30 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-methylbut-1-enyl]-2-fluorophenol is sourced from PubChem (CID 23946780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).