C20H21NO3 — CID 23947053
(3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 23947053) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 23947053 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3R,6S,7aS)-6-benzyl-3-(4-methoxyphenyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | COc1ccc([C@H]2OC[C@@H]3C[C@H](Cc4ccccc4)C(=O)N32)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-23-18-9-7-15(8-10-18)20-21-17(13-24-20)12-16(19(21)22)11-14-5-3-2-4-6-14/h2-10,16-17,20H,11-13H2,1H3/t16-,17-,20+/m0/s1 |
| InChIKey | WYGIKHGCQWMKRZ-ABSDTBQOSA-N |
| XLogP | 3.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |