C20H15F4NO — CID 23947491
(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 23947491) has the molecular formula C20H15F4NO and a molecular weight of 361.34 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 23947491 |
| Molecular Formula | C20H15F4NO |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CN1C/C(=C\c2ccc(F)c(F)c2)C(=O)/C(=C/c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C20H15F4NO/c1-25-10-14(6-12-2-4-16(21)18(23)8-12)20(26)15(11-25)7-13-3-5-17(22)19(24)9-13/h2-9H,10-11H2,1H3/b14-6+,15-7+ |
| InChIKey | MCMSKNSVBYTVHK-MKFXEVHTSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|