C16H25NO4 — CID 23947578
(3aS,4R,7aR)-4-(hydroxymethyl)-5-[(1R)-1-hydroxypentyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23947578) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (3aS,4R,7aR)-4-(hydroxymethyl)-5-[(1R)-1-hydroxypentyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-4-(hydroxymethyl)-5-[(1R)-1-hydroxypentyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23947578 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (3aS,4R,7aR)-4-(hydroxymethyl)-5-[(1R)-1-hydroxypentyl]-2,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC[C@@H](O)C1=C(C)C[C@H]2C(=O)N(C)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C16H25NO4/c1-4-5-6-12(19)13-9(2)7-10-14(11(13)8-18)16(21)17(3)15(10)20/h10-12,14,18-19H,4-8H2,1-3H3/t10-,11+,12-,14-/m1/s1 |
| InChIKey | MBOZIIUVZWYMTN-GFQSEFKGSA-N |
| XLogP | 1.10 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|