C20H19BrN2O6 — CID 23948455
[(E,1R,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate (PubChem CID 23948455) has the molecular formula C20H19BrN2O6 and a molecular weight of 463.28 g/mol. Its IUPAC name is [(E,1R,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23948455 |
| Molecular Formula | C20H19BrN2O6 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [(E,1R,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
| SMILES | C[C@H](/C=C/C(=O)NO)[C@@H](OC(=O)NC(=O)c1ccccc1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C20H19BrN2O6/c1-12(7-10-17(25)23-28)18(15-11-14(21)8-9-16(15)24)29-20(27)22-19(26)13-5-3-2-4-6-13/h2-12,18,24,28H,1H3,(H,23,25)(H,22,26,27)/b10-7+/t12-,18-/m1/s1 |
| InChIKey | PUDMUGLZIUNYDB-HHYAVSCYSA-N |
| XLogP | 3.46 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|