C21H22Cl2N2O5S — CID 2394866
[(2S)-1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 2394866) has the molecular formula C21H22Cl2N2O5S and a molecular weight of 485.39 g/mol. Its IUPAC name is [(2S)-1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(2S)-1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2394866 |
| Molecular Formula | C21H22Cl2N2O5S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [(2S)-1-(3,5-dichloroanilino)-1-oxopropan-2-yl] 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H22Cl2N2O5S/c1-14(20(26)24-18-12-16(22)11-17(23)13-18)30-21(27)15-5-7-19(8-6-15)31(28,29)25-9-3-2-4-10-25/h5-8,11-14H,2-4,9-10H2,1H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | JLBAKVJGDBQPKQ-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |