C18H32N4O4+2 — CID 2394973
1-morpholin-4-yl-2-[4-(2-morpholin-4-yl-2-oxoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone (PubChem CID 2394973) has the molecular formula C18H32N4O4+2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[4-(2-morpholin-4-yl-2-oxoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone.
| Compound Name | 1-morpholin-4-yl-2-[4-(2-morpholin-4-yl-2-oxoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone |
|---|---|
| PubChem CID | 2394973 |
| Molecular Formula | C18H32N4O4+2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-morpholin-4-yl-2-[4-(2-morpholin-4-yl-2-oxoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethanone |
| SMILES | O=C(C[N+]12CC[N+](CC(=O)N3CCOCC3)(CC1)CC2)N1CCOCC1 |
| InChI | InChI=1S/C18H32N4O4/c23-17(19-1-11-25-12-2-19)15-21-5-8-22(9-6-21,10-7-21)16-18(24)20-3-13-26-14-4-20/h1-16H2/q+2 |
| InChIKey | IVADSZWBIUYQJY-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|